19(R)-Hydroxy prostaglandin E1 | MedChemExpress (MCE)
19(R)-Hydroxy prostaglandin E1 (19(R)-Hydroxy PGE1), the major prostaglandin in primate semen, is an agonist of EP1 and EP3 receptor subtypes and exhibits contractile activity on smooth muscle preparations[1][2].
| Trivial name | 19(R)-Hydroxy prostaglandin E1 |
| Catalog Number | HY-137574 |
| Alternative Name(s) | 19(R)-Hydroxy PGE1 |
| Research Area | Others |
| CAS# | 64625-55-4 |
| Purity | ≥98.0% |
| SMILES | OC(CCCCCC[C@@H]1[C@H]([C@@H](CC1=O)O)/C=C/[C@@H](O)CCC[C@H](O)C)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/19-r-hydroxy-prostaglandin-e1.html |