A2AAR/hMAO-B-IN-1 | MedChemExpress (MCE)
A2AAR/hMAO-B-IN-1 (compoudn 17) is a non-xanthine dual-target inhibitor targeting the A2A adenosine receptor (A2AAR) (IC50: 34.9 nM) andMAO-B (Ki: 39.5 nM, human). A2AAR/hMAO-B-IN-1 inhibits A2AAR-induced cAMP accumulation and exhibits competitive, reversible inhibition of MAO-B. A2AAR/hMAO-B-IN-1 can be used in the study of neurodegenerative diseases such as Parkinson’s disease (PD)[1].
| Trivial name | A2AAR/hMAO-B-IN-1 |
| Catalog Number | HY-120826 |
| Research Area | Neurological Disease |
| CAS# | 1439488-21-7 |
| Purity | ≥98.0% |
| SMILES | O=C1SC(NC(CCCC2=CC=CC=C2)=O)=NC3=C1C=CC=C3 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/a2aar-hmao-b-in-1.html |