Prostaglandin E2 serinol amide | MedChemExpress (MCE)
Prostaglandin E2 serinol amide is a weak inhibitor of the hydrolysis of [3H]2-oleoylglycerol. Prostaglandin E2 serinol amide is non-hydrolyzable to produce PGE2 and thus cannot inhibit leukotriene B4 biosynthesis, superoxide production, migration and antimicrobial peptide release[1].
| Trivial name | Prostaglandin E2 serinol amide |
| Catalog Number | HY-118556 |
| Research Area | Endocrinology |
| CAS# | 951209-67-9 |
| Purity | ≥98.0% |
| SMILES | OCC(CO)NC(CCC/C=C\C[C@@H]1[C@H]([C@@H](CC1=O)O)/C=C/[C@@H](O)CCCCC)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/prostaglandin-e2-serinol-amide.html |