Prostaglandin F2α alcohol methyl ether | MedChemExpress (MCE)
Prostaglandin F2α alcohol methyl ether is an alcohol methyl ether G protein-coupled receptor. Prostaglandin F2α is also a luteinizing hormone in sheep and may be a nociceptive mediator in the spinal cord[1][2][3].
| Trivial name | Prostaglandin F2α alcohol methyl ether |
| Catalog Number | HY-117061 |
| Research Area | Endocrinology |
| CAS# | 143656-18-2 |
| Purity | ≥98.0% |
| SMILES | COCCCC/C=C\C[C@@H]1[C@H]([C@@H](C[C@@H]1O)O)/C=C/[C@@H](O)CCCCC |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/prostaglandin-f2α-alcohol-methyl-ether.html |