D-threo-PDMP hydrochloride | MedChemExpress (MCE)
D-threo-PDMP hydrochloride is a glucosylceramide (GlcCer) synthase inhibitor that inhibits glucosylceramide (GlcCer) and lactosylceramide (LacCer) levels in B16 melanoma cells. D-threo-PDMP hydrochloride lacks reactivity to the other two surface antigens anti-melanoma monoclonal antibodies M562 and M622 and the major histocompatibility antigen anti-H-2KbDb monoclonal antibody, so it is specific for B16 melanoma sex[1].
| Trivial name | D-threo-PDMP hydrochloride |
| Catalog Number | HY-116392F |
| Research Area | Cancer |
| CAS# | 139889-62-6 |
| Purity | ≥98.0% |
| SMILES | CCCCCCCCCC(N[C@H](CN1CCOCC1)[C@H](O)C2=CC=CC=C2)=O.Cl[H] |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/d-threo-pdmp-hydrochloride.html |