Prostaglandin F2α serinol amide | MedChemExpress (MCE)
Prostaglandin F2α serinol amide is a serinolamide G protein-coupled receptor that increases calcium levels in human non-small cell lung cancer cells. Prostaglandin F2α is also a luteinizing hormone in sheep and may be a nociceptive mediator in the spinal cord[1][2][3].
| Trivial name | Prostaglandin F2α serinol amide |
| Catalog Number | HY-114810 |
| Research Area | Endocrinology |
| CAS# | 1135226-99-1 |
| Purity | ≥98.0% |
| SMILES | OCC(CO)NC(CCC/C=C\C[C@@H]1[C@H]([C@@H](C[C@@H]1O)O)/C=C/[C@@H](O)CCCCC)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/prostaglandin-f2α-serinol-amide.html |