Nav1.7-IN-13 | MedChemExpress (MCE)
Nav1.7-IN-13 (compound 3g) is a sodium channel inhibitor that significantly inhibits Veratridine (HY-N6691)-induced neuronal activity. Nav1.7-IN-13 inhibits total Na+ current in DRG neurons in a concentration-dependent manner; slows down the activation of Navs. Nav1.7-IN-13 significantly alleviated mechanical pain behavior in a rat model of nerve injury (SNI) and had analgesic activity[1].
| Trivial name | Nav1.7-IN-13 |
| Catalog Number | HY-162347 |
| Research Area | Neurological Disease |
| Purity | ≥98.0% |
| SMILES | C/C(C)=C/CN1C2=CC(Br)=CC=C2[C@@]([C@@]3(C(OC)=O)OC(C=CC=C4)=C4C3)(O)C1=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/nav1-7-in-13.html |
