Iodoantipyrine | MedChemExpress (MCE)
Iodoantipyrine (4-Iodoantipyrine) is an iodinated Antipyrine (HY-B0171) with potential antiviral activity. Antipyrine (Phenazone) is an antipyretic and analgesic that also serves as a molecular probe of hepatic oxidative metabolites[1][2].
| Trivial name | Iodoantipyrine |
| Catalog Number | HY-116070 |
| Alternative Name(s) | 4-Iodoantipyrine |
| Research Area | Infection |
| CAS# | 129-81-7 |
| Purity | ≥98.0% |
| SMILES | O=C1N(N(C(C)=C1I)C)C2=CC=CC=C2 |
| Size | 100 mg |
| Supplier Page | https://www.medchemexpress.com/iodoantipyrine.html |