EBP-IN-1 | MedChemExpress (MCE)
EBP-IN-1 (compound 11) is an inhibitor of emopamil-binding protein (EBP), a sterol isomerase in the cholesterol biosynthetic pathway. EBP-IN-1 has a long half-life in rodents and has good metabolic turnover and brain penetration properties. EBP-IN-1 enhances oligodendrocyte formation in human cortical organoids[1].
| Trivial name | EBP-IN-1 |
| Catalog Number | HY-162351 |
| Research Area | Metabolic Disease |
| Purity | ≥98.0% |
| SMILES | CCN1C(N(C2=CC=C(C3CC3)C=C2)C(C14CCN(CC5CCOCC5)CC4)=O)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/ebp-in-1.html |