2,3-Diphenylquinoxaline-6-carboxylic acid | MedChemExpress (MCE)
2,3-Diphenylquinoxaline-6-carboxylic acid is used for end-capping in the synthesis of AB2 monomers, which facilitates the synthesis and chain-end modification of hyperbranched polymers containing alternating quinoxaline and benzoxazole repeating units[1].
Trivial name | 2,3-Diphenylquinoxaline-6-carboxylic acid |
Catalog Number | HY-W028714 |
Research Area | Others |
CAS# | 32387-96-5 |
Purity | ≥98.0% |
SMILES | O=C(O)C1=CC2=NC(C3=CC=CC=C3)=C(N=C2C=C1)C4=CC=CC=C4 |
Size | 1 mg |
Supplier Page | https://www.medchemexpress.com/2-3-diphenylquinoxaline-6-carboxylic-acid.html |