Veldoreotide TFA | MedChemExpress (MCE)
Veldoreotide (DG3173) TFA a somatostatin analogue, binds to and activate the somatostatin receptors (SSTR) 2, 4, and 5. Veldoreotide TFA inhibits growth hormone (GH) secretion in adenomas compared with Octreotide (HY-P0036). Veldoreotide has the potential to be used as pain modulating agent[1]
| Trivial name | Veldoreotide TFA |
| Catalog Number | HY-P0024A |
| Alternative Name(s) | DG3173 TFA; PTR-3173 TFA |
| Research Area | Endocrinology; Cancer |
| CAS# | 2126831-23-8 |
| Purity | 98.4% |
| SMILES | O=C(N[C@@H](C(N[C@H](C(N[C@@](C(N[C@H](C1=O)CC2=CC=CC=C2)=O)([H])[C@H](O)C)=O)CCCCN)=O)CC3=CNC4=CC=CC=C34)[C@@H](NC([C@@H](NC(CCCNC(CCCN1CC(N)=O)=O)=O)CC5=CC=CC=C5)=O)CC6=CNC7=CC=CC=C67.OC(C(F)(F)F)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/veldoreotide-tfa.html |
