17β-Hydroxywortmannin | MedChemExpress (MCE)
17β-Hydroxywortmannin (Wortmannin-17β-ol) is an orally active inhibitor for phosphatidylinositol-3-kinase (PI-3-kinase) with an IC50 of 0.5 nM, suppresses the osteoclast resorption with an IC50 of 10 nM[1]. 17β-Hydroxywortmannin exhibits antitumor activity[2].
| Trivial name | 17β-Hydroxywortmannin |
| Catalog Number | HY-126083 |
| Alternative Name(s) | Wortmannin-17β-ol |
| Research Area | Cancer; Others |
| CAS# | 58053-83-1 |
| Purity | ≥98.0% |
| SMILES | C[C@@]12C3=C(C(C4=C1C(C(O[C@@H]2COC)=O)=CO4)=O)[C@@]5([H])[C@](C[C@H]3OC(C)=O)([C@H](CC5)O)C |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/17β-hydroxywortmannin.html |