13,14-Dihydro-15-keto-prostaglandin A2 | MedChemExpress (MCE)
13,14-Dihydro-15-keto-prostaglandin A2 is a product of the non-enzymatic dehydration of 13,14-dihydro-15-keto PGE2. It is further broken down into bicyclo PGE2, which acts as a biomarker for PGE2 synthesis[1].
| Trivial name | 13,14-Dihydro-15-keto-prostaglandin A2 |
| Catalog Number | HY-113461 |
| Research Area | Others |
| CAS# | 74872-89-2 |
| Purity | ≥98.0% |
| SMILES | CCCCCC(CC[C@@H]1[C@H](C(C=C1)=O)C/C=C\CCCC(O)=O)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/13-14-dihydro-15-keto-prostaglandin-a2.html |