Homobotcinolide | MedChemExpress (MCE)
Homobotcinolide is a novel bioactive natural product that can be isolated from Botrytis cinerea infecting raspberry fruit (Rubus ideaus). Homobotcinolide significantly inhibited the growth of yellowed wheat germ tissue[1].
| Trivial name | Homobotcinolide |
| Catalog Number | HY-N12652 |
| Alternative Name(s) | Botcineric acid |
| Research Area | Infection |
| CAS# | 177182-59-1 |
| Purity | ≥98.0% |
| SMILES | OC([C@H](C)[C@@H]([C@@]1([C@H]([C@@H]([C@H]([C@@H](O1)C)OC(/C=C/[C@@H](O)CCCCCC)=O)C)O)C)O)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/homobotcinolide.html |