OH-C-Chol | MedChemExpress (MCE)
OH-C-Chol is a cationic liposome that serves as a siRNA delivery vehicle. OH-C-Chol (LP-C) and OH-NC-Chol (LP-NC)/siRNA complexes (lipoplexes) showed better performance than NP-C and NP-NC/siRNA complexes (nanocomplexes), respectively. ) greater gene silencing effect[1].
| Trivial name | OH-C-Chol |
| Catalog Number | HY-160581 |
| Research Area | Others |
| CAS# | 496801-51-5 |
| Purity | ≥98.0% |
| SMILES | C[C@@]12[C@]3([H])[C@](CC=C1C[C@H](CC2)OC(NCCNCCO)=O)([H])[C@@]4([H])[C@](CC3)([C@@](CC4)([H])[C@H](C)CCCC(C)C)C |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/oh-c-chol.html |