(24S,25)-Epoxycholesterol | MedChemExpress (MCE)
24S,25-Epoxycholesterol is an agonist for Liver X Receptor (LXR). 24S,25-Epoxycholesterol exhibits properties in regulating the cholesterol efflux[1], inhibiting tumor growth against gastric cancer and glioblastoma[2][3] and inducing apoptosis in BMMC cells[5].
| Trivial name | (24S,25)-Epoxycholesterol |
| Catalog Number | HY-W040150 |
| Research Area | Neurological Disease; Inflammation/Immunology; Cancer |
| CAS# | 77058-74-3 |
| Purity | ≥98.0% |
| SMILES | C[C@@]12[C@](CC[C@]2([H])[C@H](C)CC[C@H]3C(C)(O3)C)([H])[C@@]4([H])[C@@](CC1)([H])[C@@]5(C(C[C@H](CC5)O)=CC4)C |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/24s-25-epoxycholesterol.html |