NTPO trisodium | MedChemExpress (MCE)
NTPO trisodium is a DNA damage inducer, causing genomic DNA damage and fragmentation, activating ATR-mediated cell cycle checkpoints. The DNA damaging effects of NTPO trisodium are abrogated by base excision repair (BER) but not nucleotide excision repair (NER)[1].
| Trivial name | NTPO trisodium |
| Catalog Number | HY-W011425A |
| Alternative Name(s) | Nitrilotris(methylenephosphonic acid), trisodium salt |
| Research Area | Cancer |
| CAS# | 7611-50-9 |
| Purity | ≥98.0% |
| SMILES | O=P(CN(CP(O)(O[Na])=O)CP(O)(O[Na])=O)(O[Na])O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/ntpo-trisodium.html |