TAPS sodium | MedChemExpress (MCE)
TAPS sodium is a biological buffer that protects the structural integrity of lysozyme bacteria and prevents them from thermal denaturation at high temperatures. A pKa of 8.1 for TAPS results in half-maximal connexin channel activity[1][2].
| Trivial name | TAPS sodium |
| Catalog Number | HY-W040263 |
| Alternative Name(s) | TAPS Na |
| Research Area | Others |
| CAS# | 91000-53-2 |
| Purity | ≥98.0% |
| SMILES | O=S(CCCNC(CO)(CO)CO)(O[Na])=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/taps-sodium.html |