PIPES monosodium | MedChemExpress (MCE)
PIPES (1,4-Piperazinediethanesulfonic acid) monosodium is a pH buffer that can be mixed with another disodium salt form of PIPES. By changing the ratio and total amount of the PIPES monosodium and disodium buffers, the pH and ionic strength of the medium can be changed[1].
Trivial name | PIPES monosodium |
Catalog Number | HY-W011271 |
Alternative Name(s) | 1,4-Piperazinediethanesulfonic acid monosodium |
Research Area | Others |
CAS# | 10010-67-0 |
Purity | ≥98.0% |
SMILES | O=S(CCN1CCN(CCS(=O)(O)=O)CC1)(O[Na])=O |
Size | 10 g |
Supplier Page | https://www.medchemexpress.com/pipes-monosodium.html |