BODIPY 650/665 NHS ester | MedChemExpress (MCE)
BODIPY 650/665 NHS ester is bright, far-red fluorescent dye that can be used to label the primary amines (R-NH2) of proteins, amine-modified oligonucleotides, and other amine-containing molecules[1]. Ex / Em = 646 / 660 nm
| Trivial name | BODIPY 650/665 NHS ester |
| Catalog Number | HY-D1692 |
| Research Area | Others |
| CAS# | 1818267-45-6 |
| Purity | ≥98.0% |
| SMILES | O=C(CCCCNC(COC1=CC=C(/C=C/C2=CC=C3C=C4C=CC(C5=CC=CN5)=[N]4[B+3]([F-])([N-]23)[F-])C=C1)=O)ON6C(CCC6=O)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/bodipy-650-665-nhs-ester.html |