5-Aminoimidazole ribonucleotide | MedChemExpress (MCE)
5-Aminoimidazole ribonucleotide (AIR) is an intermediate in the biosynthesis of purines, as AIR is further modified by additional enzymes to eventually produce inosine monophosphate (IMP), which can then be converted into the purine bases adenine (A) and guanine (G)[1].
| Trivial name | 5-Aminoimidazole ribonucleotide |
| Catalog Number | HY-133155 |
| Research Area | Metabolic Disease |
| CAS# | 25635-88-5 |
| Purity | ≥98.0% |
| SMILES | O[C@H]1[C@@H](O)[C@H](N2C(N)=CN=C2)O[C@@H]1COP(O)(O)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/5-aminoimidazole-ribonucleotide.html |