Kalibor | MedChemExpress (MCE)
Kalibor (Sodium tetraphenylborate; Tetraphenylboron sodium) is a precipitating agent, performing a precipitating function in the gravimetric determination of various monovalent cations such as basic organic nitrogen compounds and metal ions[1].
| Trivial name | Kalibor |
| Catalog Number | HY-W025784 |
| Alternative Name(s) | Sodium tetraphenylborate; Tetraphenylboron sodium |
| Research Area | Others |
| CAS# | 143-66-8 |
| Purity | ≥99.0% |
| SMILES | [C-]1([B+3]([C-]2=CC=CC=C2)([C-]3=CC=CC=C3)[C-]4=CC=CC=C4)=CC=CC=C1.[Na+] |
| Size | 5 g |
| Supplier Page | https://www.medchemexpress.com/kalibor.html |