EDTA-OH | MedChemExpress (MCE)
EDTA-OH is a chelating agent, which forms thermodynamically stable chelates with metal ions like calcium, magnesium, iron, zinc and copper[1]. EDTA-OH exhibits ability of phytoremediation in heavy-metal-contaminated soils[2]. EDTA-OH is able to cross brain-blood barrier[3].
| Trivial name | EDTA-OH |
| Catalog Number | HY-W013851 |
| Research Area | Others |
| CAS# | 150-39-0 |
| Purity | ≥98.0% |
| SMILES | O=C(O)CN(CCO)CCN(CC(O)=O)CC(O)=O |
| Size | 25 g |
| Supplier Page | https://www.medchemexpress.com/edta-oh.html |