Bicyclo-PGE1 | MedChemExpress (MCE)
Bicyclo-PGE1 (Bicyclo Prostaglandin E1) is a stable, base-catalyzed transformation product of the PGE1 metabolite 13,14-dihydro-15-keto PGE1. Bicyclo-PGE1 can be used to estimate the biosynthesis and metabolism of PGE1 in vivo[1].
| Trivial name | Bicyclo-PGE1 |
| Catalog Number | HY-157925 |
| Alternative Name(s) | Bicyclo Prostaglandin E1 |
| Research Area | Others |
| CAS# | 1283861-32-4 |
| Purity | ≥98.0% |
| SMILES | OC(CCCCCC[C@@H]1[C@]2([H])[C@@](CC1=O)([H])C(C(CC2)=O)CCCC)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/bicyclo-pge1.html |