17-HETE | MedChemExpress (MCE)
17-HETE is arachidonic acid metabolite through cytochrome P-450 pathways, which consists of 17R-HETE and 17S-HETE enantiomers. 17-HETE serves as allosteric activator of the cytochrome P450 1B1 and inhibitor of ATPase, induces cardic hypertrophy[1][2].
| Trivial name | 17-HETE |
| Catalog Number | HY-116196 |
| Research Area | Inflammation/Immunology; Cardiovascular Disease |
| CAS# | 128914-47-6 |
| Purity | ≥98.0% |
| SMILES | CCCC(C/C=C\C/C=C\C/C=C\C/C=C\CCCC(O)=O)O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/17-hete.html |