Olorofim | MedChemExpress (MCE)
Olorofim (F901318) selectively inhibits fungal dihydroorotate dehydrogenase (DHODH), a key enzyme in the pyrimidine biosynthesis pathway. Olorofim (F901318). Olorofim exhibits excellent activity against A. fumigatus and other Aspergillus spp.[1].
| Trivial name | Olorofim |
| Catalog Number | HY-104029 |
| Alternative Name(s) | F901318 |
| Research Area | Infection |
| CAS# | 1928707-56-5 |
| Purity | 98.8% |
| SMILES | O=C(NC1=CC=C(N2CCN(C3=NC=C(F)C=N3)CC2)C=C1)C(C4=C(C5=CC=CC=C5)C=C(C)N4C)=O |
| Size | 10 mg |
| Supplier Page | https://www.medchemexpress.com/olorofim.html |