NT157 | MedChemExpress (MCE)
NT157 (Tyrphostin NT157) is a selective IRS-1/2 inhibitor that induces Ser-phosphorylation and consequently the degradation of IRS-1/2. NT157 (Tyrphostin NT157) is a first-in-class anti-cancer agent that also targets Stat3 signaling pathway[1][2].
| Trivial name | NT157 |
| Catalog Number | HY-100037 |
| Alternative Name(s) | Tyrphostin NT157 |
| CAS# | 1384426-12-3 |
| Purity | 99.2% |
| SMILES | S=C(NCC1=CC(O)=C(O)C(O)=C1)/C=C/C2=CC(O)=C(O)C(Br)=C2 |
| Size | 25 mg |
| Supplier Page | https://www.medchemexpress.com/NT157.html |