5,7-Dihydroxy-11-ketotetranorprostanoic acid | MedChemExpress (MCE)
5,7-Dihydroxy-11-ketotetranorprostanoic acid is a urinary metabolite of prostaglandin F2α and precursor to tetranor-PGF metabolites, exhibits hardly activity in blood pressure assay and smooth muscle stiumulation assay[1].
| Trivial name | 5,7-Dihydroxy-11-ketotetranorprostanoic acid |
| Catalog Number | HY-114687 |
| Research Area | Others |
| CAS# | 24379-94-0 |
| Purity | ≥98.0% |
| SMILES | CCCCCC(CC[C@@H]1[C@H]([C@H](C[C@H]1O)O)CCC(O)=O)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/5-7-dihydroxy-11-ketotetranorprostanoic-acid.html |