244cis | MedChemExpress (MCE)
244cis, a piperazine-containing ionizable cationic lipid, has been used to generate lipid nanoparticles (LNPs). LNPs containing 244cis and coated with mRNA reporter gene were specifically accumulated in mouse lungs compared with LNPs containing SM-102. Induces a decrease in serum chemokine (C-C motif) ligand 2 (CCL2) levels[1].
| Trivial name | 244cis |
| Catalog Number | HY-160552 |
| Research Area | Others |
| CAS# | 2956402-64-3 |
| Purity | ≥98.0% |
| SMILES | CCCCCC/C=C\COC(CCCCCCCCN(CCCCCCCCC(OC/C=C\CCCCCC)=O)CCN1CCN(CC1)CCCCCCCCC(OC/C=C\CCCCCC)=O)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/244cis.html |