Targocil-II | MedChemExpress (MCE)
Targocil-II (Compound 2) is an ABC transporter inhibitor with a IC50 value of 137 nM. Targocil-II prevents ATP hydrolysis by binding to allosteric sites of the TM domain. Targocil-II has (antibacterial) activity[1].
| Trivial name | Targocil-II |
| Catalog Number | HY-160519 |
| Research Area | Infection |
| CAS# | 955918-74-8 |
| Purity | 98.9% |
| SMILES | CC1=C2C(C(C3=CC=C(C=C3)Cl)=CO2)=CC4=C1OC(C(CC(N5[C@@H](CCC5)C(O)=O)=O)=C4C)=O |
| Size | 5 mg |
| Supplier Page | https://www.medchemexpress.com/targocil-ii.html |
