PGDM | MedChemExpress (MCE)
PGDM (Prostaglandin D Metabolite) is the main urinary metabolite of Prostaglandin D2 and is prone to reversible cyclization. PGDM may serve as a biomarker for the endogenous production of PGD2 or be used to evaluate the severity of acute allergic reactions[1].
| Trivial name | PGDM |
| Catalog Number | HY-117659 |
| Alternative Name(s) | Prostaglandin D Metabolite |
| Research Area | Inflammation/Immunology |
| CAS# | 133161-96-3 |
| Purity | ≥98.0% |
| SMILES | OC(CCC(CC[C@@H]1[C@H]([C@H](C[C@@H]1O)O)C/C=C\CC(O)=O)=O)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/pgdm.html |