Nrf2 degrader 1 | MedChemExpress (MCE)
Nrf2 degrader 1 (compound 1) is a PROTAC Nrf2 degrader with anticancer effects. Nrf2 degrader 1 inhibits cancer cells growth for A549 and LK-2 cells with IC50 values of 100 nM and 40 nM, respectively[1].
| Trivial name | Nrf2 degrader 1 |
| Catalog Number | HY-162307 |
| Research Area | Cancer |
| CAS# | 3025286-00-1 |
| Purity | ≥98.0% |
| SMILES | O=C1NC(C(N2C(C(C(NCCOCCOC3=CC(CC(NC4=NC(C5=CC=C(N(C(C6=C(C)C=CC=C6)=O)CC7)C7=C5)=C(C)S4)=O)=CC=C3)=CC=C8)=C8C2=O)=O)CC1)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/nrf2-degrader-1.html |