Avenanthramide-C methyl ester | MedChemExpress (MCE)
Avenanthramide-C methyl ester is an anti-inflammatory agent and NF-κB inhibitor that inhibits the secretion of pro-inflammatory factors. Avenanthramide-C methyl ester inhibits NF-κB activation by inhibiting IKK and IκB phosphorylation and inhibiting proteasome activity[1].
| Trivial name | Avenanthramide-C methyl ester |
| Catalog Number | HY-138284 |
| Research Area | Inflammation/Immunology |
| CAS# | 955382-52-2 |
| Purity | ≥98.0% |
| SMILES | COC(C1=C(C=CC(O)=C1)NC(/C=C/C2=CC(O)=C(C=C2)O)=O)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/avenanthramide-c-methyl-ester.html |