ATB-343 | MedChemExpress (MCE)
ATB-343 is a derivative of Indomethacin that releases H2S. H2S has cytoprotective and anti-inflammatory effects, inhibiting leukocyte adhesion to vascular endothelium and leukocyte migration to inflammatory sites. ATB-343 can be used to suppress respiratory infections[1][2].
| Trivial name | ATB-343 |
| Catalog Number | HY-15033 |
| Research Area | Inflammation/Immunology; Infection |
| CAS# | 1000700-26-4 |
| Purity | ≥98.0% |
| SMILES | O=C(CC1=C(C)N(C(C2=CC=C(C=C2)Cl)=O)C3=C1C=C(C=C3)OC)OC4=CC=C(C(SS5)=CC5=S)C=C4 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/atb-343.html |