15-Deoxy-Δ12,14-prostaglandin A1 | MedChemExpress (MCE)
15-Deoxy-Δ12,14-prostaglandin A1 is a deoxyanalog of prostaglandins that inhibits NF-κB signaling and induces apoptosis. 15-Deoxy-Δ12,14-prostaglandin A1 inhibits TNF-α-induced upregulation of inflammatory endothelial cell adhesion molecule (CAM) and avoids monocyte arrest[1].
| Trivial name | 15-Deoxy-Δ12,14-prostaglandin A1 |
| Catalog Number | HY-118101 |
| Research Area | Inflammation/Immunology |
| CAS# | 573951-20-9 |
| Purity | ≥98.0% |
| SMILES | OC(CCCCCC[C@@H]1/C(C=CC1=O)=C\C=C\CCCCC)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/15-deoxy-12-14-prostaglandin-a1.html |