URB447 | MedChemExpress (MCE)
URB447 is a peripherally restricted CB1 cannabinoid antagonist (IC50: 313 nM and 41 nM for rat CB1 and human CB2 receptor respectively ). URB447 lowers food intake and body-weight gain in mice without entering the brain or antagonizing central CB1-dependent responses. URB447 can be used for research of obesity[1].
| Trivial name | URB447 |
| Catalog Number | HY-122964 |
| Research Area | Metabolic Disease |
| CAS# | 1132922-57-6 |
| Purity | ≥98.0% |
| SMILES | O=C(C1=C(C)N(CC2=CC=C(C=C2)Cl)C(C3=CC=CC=C3)=C1N)C4=CC=CC=C4 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/urb447.html |