JBC117 | MedChemExpress (MCE)
JBC117 is a novel anticancer lead compound targeting Pygo2 PHD. JBC117 can effectively antagonize the cell effect of β-catenin-dependent activity and inhibit the migration and invasion of cancer cells. JBC117 can induce apoptosis[1].
| Trivial name | JBC117 |
| Catalog Number | HY-157891 |
| Research Area | Cancer |
| CAS# | 1214531-21-1 |
| Purity | ≥98.0% |
| SMILES | OC(CN1CCC2(CC1)OC3=C(C(C2)O)C=CC4=C3C=CC=C4)C5=CNC6=C5C=CC(C)=C6 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/jbc117.html |