mTOR inhibitor-18 | MedChemExpress (MCE)
mTOR inhibitor-18 (Example 106) is a mTOR inhibitor. mTOR inhibitor-18 can be used for mTOR related research, such as cancer, immune disorders, cardiovascular disease, viral infection, inflammation, metabolism/endocrine function disorders and neurological disorders[1].
| Trivial name | mTOR inhibitor-18 |
| Catalog Number | HY-160548 |
| Research Area | Neurological Disease; Metabolic Disease; Inflammation/Immunology; Infection; Cancer |
| CAS# | 2170358-67-3 |
| Purity | ≥98.0% |
| SMILES | S=C(NC1=CC=C(C2=NN3C=CC=C3C(N4CCOCC4)=N2)C=C1)NC5=CC=CN=C5 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/mtor-inhibitor-18.html |