ZNF207-IN-1 | MedChemExpress (MCE)
ZNF207-IN-1 (compound C16) is a potent inhibitor of Zinc Finger Protein 207 (ZNF207)， with IC50 values ranging from 0.5–2.5 μM for inhibiting sphere formation and 0.5–15 μM for cytotoxicity. ZNF207-IN-1 exhibites efficient permeability across the blood–brain barrier[1].
| Trivial name | ZNF207-IN-1 |
| Catalog Number | HY-161303 |
| Research Area | Cancer |
| Purity | ≥98.0% |
| SMILES | O=C(NCCC1CCN(CC2=CC=CC=C2)CC1)C3(C#N)CC4(Br)C(C=CC=C5)=C5C3C6C4C=CC=C6 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/znf207-in-1.html |