HDAC6-IN-32 | MedChemExpress (MCE)
HDAC6-IN-32 (compound 25202) is a selective and potent inhibitor of HDAC6. HDAC6-IN-32 blocks HDAC6 activity and interferes with microtubule dynamics, leading to SAC activation and prolonged mitotic arrest, ultimately leading to apoptosis in CRPC cells[1].

Trivial name | HDAC6-IN-32 |
Catalog Number | HY-161287 |
Research Area | Cancer |
Purity | ≥98.0% |
SMILES | CC1=CN2C(N(CC3=CC=C(C(NO)=O)C=C3)C4=CC=CC=C4C2=N1)=O |
Size | 1 mg |
Supplier Page | https://www.medchemexpress.com/hdac6-in-32.html |