Fli-1-IN-1 | MedChemExpress (MCE)
Fli-1-IN-1 (compound 21) is a FLI1 targeting agent that directly binds to and inhibits the EWS-FLI1 protein interaction. EWS-FLI1 can bind to RNA helicase A, and Fli-1-IN-1 inhibits EWS-FLI1 and has potential anticancer activity[1].
| Trivial name | Fli-1-IN-1 |
| Catalog Number | HY-163325A |
| Research Area | Cancer |
| CAS# | 3027140-81-1 |
| Purity | ≥98.0% |
| SMILES | COC1=CC(OC)=C([C@@]2([C@@H](C[C@H]3C4=CC=CC=C4)O)O)C(O[C@]23C(C=C5)=CC=C5OCCCCCN6CCN(C)CC6)=C1 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/fli-1-in-1.html |