Fli-1-IN-1 fumarate | MedChemExpress (MCE)
Fli-1-IN-1 (compound 21) fumarate is a FLI1 targeting agent that directly binds to and inhibits the EWS-FLI1 protein interaction. EWS-FLI1 can bind to RNA helicase A, and Fli-1-IN-1 fumarate inhibits EWS-FLI1 and has potential anticancer activity[1].
Trivial name | Fli-1-IN-1 fumarate |
Catalog Number | HY-163325 |
Research Area | Cancer |
Purity | ≥98.0% |
SMILES | COC1=CC(OC)=C([C@@]2([C@@H](C[C@H]3C4=CC=CC=C4)O)O)C(O[C@]23C(C=C5)=CC=C5OCCCCCN6CCN(C)CC6)=C1.O=C(O)/C=C/C(O)=O |
Size | 1 mg |
Supplier Page | https://www.medchemexpress.com/fli-1-in-1-fumarate.html |