2-Me PeER | MedChemExpress (MCE)
2-Me PeER is a rhodamine dye-based fluorescent probe that detects CYP3A4 activity. In fluorescence-activated cell sorting (FACS) based on CYP3A4 activity, homogeneous and functional human induced pluripotent stem cell (hiPSC)-derived hepatocytes and intestinal epithelial cells can be obtained with the aid of 2-Me PeER[1].
| Trivial name | 2-Me PeER |
| Catalog Number | HY-163324A |
| Research Area | Others |
| Purity | ≥98.0% |
| SMILES | O=C(O)C(C=CC=C1)=C1C2=C(C=C/3)C(OC4=C2C=C(C)C(N(CCOCCCCC)C)=C4)=CC3=[N+](C)/C |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/2-me-peer.html |