15-OH Tafluprost | MedChemExpress (MCE)
15-OH Tafluprost, a prostaglandin F2a (PGF2a) analog, relieves endothelin-1 (ET-1)-induced optic nerve head (ONH) blood flow impairment and ET-1-induced contraction of isolated ciliary artery segments[1].
| Trivial name | 15-OH Tafluprost |
| Catalog Number | HY-118294 |
| Alternative Name(s) | 16-Phenoxy tetranor prostaglandin F2α isopropyl ester; 16-Phenoxy tetranor PGF2α isopropyl ester |
| Research Area | Cardiovascular Disease |
| CAS# | 130209-78-8 |
| Purity | ≥98.0% |
| SMILES | CC(C)OC(CCC/C=C\C[C@@H]1[C@H]([C@@H](C[C@@H]1O)O)/C=C/[C@@H](O)COC2=CC=CC=C2)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/15-oh-tafluprost.html |