17(R)-Resolvin D4 | MedChemExpress (MCE)
17(R)-Resolvin D4 (17(R)-RvD4) is the R-enantiomer of Resolvin D4. Resolvin D4 (RvD4), a specialized proresolving mediator, can be produced in bioactive levels during S. aureus infection[1].
| Trivial name | 17(R)-Resolvin D4 |
| Catalog Number | HY-113533A |
| Alternative Name(s) | 17(R)-RvD4 |
| Research Area | Inflammation/Immunology |
| CAS# | 528583-89-3 |
| Purity | ≥98.0% |
| SMILES | CC/C=C\C[C@@H](O)/C=C/C=C\C/C=C\C=C\C=C\[C@@H](O)[C@@H](O)CCC(O)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/17-r-resolvin-d4.html |