YPLP | MedChemExpress (MCE)
YPLP is a yeast-derived peptide Tyr-Pro-Leu-Pro, which exhibits activity in anti fatigue mechanisms through the nuclear factor erythroid-2-related factor 2 (Nrf2)- and AMP-activated protein kinase (AMPK) pathway. YPLP is orally active[1].
| Trivial name | YPLP |
| Catalog Number | HY-163315 |
| Research Area | Metabolic Disease |
| CAS# | 2414391-44-7 |
| Purity | ≥98.0% |
| SMILES | O=C(N1[C@@H](CCC1)C(N[C@@H](CC(C)C)C(N2[C@@H](CCC2)C(O)=O)=O)=O)[C@H](CC3=CC=C(C=C3)O)N |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/yplp.html |