Antibacterial agent 180 | MedChemExpress (MCE)
Antibacterial agent 180 (15g), an appropriate substrate for the type I nitro reductases (TcNTR I), is a promising antitrypanosomatid agent. Antibacterial agent 180 (15g) shows nonmutagenic potential against Salmonella typhimurium strains (TA98, TA100, and TA102)[1].
| Trivial name | Antibacterial agent 180 |
| Catalog Number | HY-163292 |
| Research Area | Infection |
| Purity | ≥98.0% |
| SMILES | O=[N+]([O-])C1=NN(C=N1)CC2=CN(N=N2)C3=CC=C(C=C3)OC(F)(F)F |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/antibacterial-agent-180.html |