α7 nAChR Modulator-2 | MedChemExpress (MCE)
α7 nAChR Modulator-2 (Compound 7b) is a α7 nAChR positive allosteric modulator (PAM) with an EC50 of 2.1 μM. α7 nAChR Modulator-2 can be used for the research of cognitive disorders[1].
| Trivial name | α7 nAChR Modulator-2 |
| Catalog Number | HY-160529 |
| Research Area | Neurological Disease |
| Purity | ≥98.0% |
| SMILES | O=C(C1=C(C)N=C(NC2=CC=C(F)C(Cl)=C2)S1)NC3=C(C)C=CC=C3C |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/α7-nachr-modulator-2.html |