Quizalofop | MedChemExpress (MCE)
Quizalofop (Xylafop) is a herbicide that inhibits acetyl-CoA carboxylase (ACCase) to reduce the synthesis of fatty acids. Quizalofop can be used to screen EMS (HY-W015854) mutated microalgae for research on improving the performance of microalgae biofuel production[1][2].
| Trivial name | Quizalofop |
| Catalog Number | HY-123307 |
| Alternative Name(s) | Xylafop |
| Research Area | Others |
| CAS# | 76578-12-6 |
| Purity | ≥98.0% |
| SMILES | CC(C(O)=O)OC1=CC=C(C=C1)OC2=NC3=CC=C(C=C3N=C2)Cl |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/quizalofop.html |