17-Phenyl-18,19,20-trinor-PGD2 | MedChemExpress (MCE)
17-Phenyl-18,19,20-trinor-PGD2 (17-Phenyl-PGD2) is an analogue of prostaglandin D2 (PGD2; HY-101988). 17-Phenyl-18,19,20-trinor-PGD2 is a potent inhibitor of platelet aggregation caused by aenosine diphosphate (ADP), with the IC50 of 8.4 μM (PGD2 IC50 = 18.6 nM). 17-Phenyl-18,19,20-trinor-PGD2 is a weak agonist of cyclic AMP accumulation[1].
| Trivial name | 17-Phenyl-18,19,20-trinor-PGD2 |
| Catalog Number | HY-137288 |
| Alternative Name(s) | 17-Phenyl-PGD2 |
| Research Area | Cardiovascular Disease |
| CAS# | 85280-91-7 |
| Purity | ≥98.0% |
| SMILES | OC(CCC/C=C\C[C@@H]1[C@H](C(C[C@@H]1O)=O)/C=C/[C@@H](O)CCC2=CC=CC=C2)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/17-phenyl-18-19-20-trinor-pgd2.html |